C16H19ClN4O4 — CID 139678645
N-[1-(2-chlorobenzoyl)-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide (PubChem CID 139678645) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is N-[1-(2-chlorobenzoyl)-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-(2-chlorobenzoyl)-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678645 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[1-(2-chlorobenzoyl)-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
| SMILES | CC1CC(CN2CCN(C(=O)c3ccccc3Cl)C2=N[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C16H19ClN4O4/c1-11-8-12(10-25-11)9-19-6-7-20(16(19)18-21(23)24)15(22)13-4-2-3-5-14(13)17/h2-5,11-12H,6-10H2,1H3 |
| InChIKey | FTFNFXSFORXWOR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|