C10H16ClN3O3 — CID 139702950
2-[chloro(nitro)methylidene]-1-[(5-methyloxolan-3-yl)methyl]imidazolidine (PubChem CID 139702950) has the molecular formula C10H16ClN3O3 and a molecular weight of 261.71 g/mol. Its IUPAC name is 2-[chloro(nitro)methylidene]-1-[(5-methyloxolan-3-yl)methyl]imidazolidine.
| Compound Name | 2-[chloro(nitro)methylidene]-1-[(5-methyloxolan-3-yl)methyl]imidazolidine |
|---|---|
| PubChem CID | 139702950 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[chloro(nitro)methylidene]-1-[(5-methyloxolan-3-yl)methyl]imidazolidine |
| SMILES | CC1CC(CN2CCNC2=C(Cl)[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C10H16ClN3O3/c1-7-4-8(6-17-7)5-13-3-2-12-10(13)9(11)14(15)16/h7-8,12H,2-6H2,1H3 |
| InChIKey | ZTQKJHWDPCVTOE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|