C10H18BrN3O3 — CID 139702658
2-bromo-1-N,1-N'-dimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine (PubChem CID 139702658) has the molecular formula C10H18BrN3O3 and a molecular weight of 308.18 g/mol. Its IUPAC name is 2-bromo-1-N,1-N'-dimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine.
| Compound Name | 2-bromo-1-N,1-N'-dimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 139702658 |
| Molecular Formula | C10H18BrN3O3 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 2-bromo-1-N,1-N'-dimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine |
| SMILES | CNC(=C(Br)[N+](=O)[O-])N(C)CC1COC(C)C1 |
| InChI | InChI=1S/C10H18BrN3O3/c1-7-4-8(6-17-7)5-13(3)10(12-2)9(11)14(15)16/h7-8,12H,4-6H2,1-3H3 |
| InChIKey | UUWXFNROCQHAMS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|