C10H17F2N3O3 — CID 139694565
N-ethyl-2,2-difluoro-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide (PubChem CID 139694565) has the molecular formula C10H17F2N3O3 and a molecular weight of 265.26 g/mol. Its IUPAC name is N-ethyl-2,2-difluoro-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide.
| Compound Name | N-ethyl-2,2-difluoro-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 139694565 |
| Molecular Formula | C10H17F2N3O3 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-ethyl-2,2-difluoro-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
| SMILES | [H]/N=C(\N(CC)CC1COC(C)C1)C(F)(F)[N+](=O)[O-] |
| InChI | InChI=1S/C10H17F2N3O3/c1-3-14(5-8-4-7(2)18-6-8)9(13)10(11,12)15(16)17/h7-8,13H,3-6H2,1-2H3/b13-9- |
| InChIKey | QOBCFTUTSFMYGX-LCYFTJDESA-N |
| XLogP | 1.58 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|