C8H13F2N3O3 — CID 139694550
2,2-difluoro-N-methyl-2-nitro-N-(oxolan-3-ylmethyl)ethanimidamide (PubChem CID 139694550) has the molecular formula C8H13F2N3O3 and a molecular weight of 237.21 g/mol. Its IUPAC name is 2,2-difluoro-N-methyl-2-nitro-N-(oxolan-3-ylmethyl)ethanimidamide.
| Compound Name | 2,2-difluoro-N-methyl-2-nitro-N-(oxolan-3-ylmethyl)ethanimidamide |
|---|---|
| PubChem CID | 139694550 |
| Molecular Formula | C8H13F2N3O3 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2,2-difluoro-N-methyl-2-nitro-N-(oxolan-3-ylmethyl)ethanimidamide |
| SMILES | [H]/N=C(\N(C)CC1CCOC1)C(F)(F)[N+](=O)[O-] |
| InChI | InChI=1S/C8H13F2N3O3/c1-12(4-6-2-3-16-5-6)7(11)8(9,10)13(14)15/h6,11H,2-5H2,1H3/b11-7- |
| InChIKey | GAHBONHPZGFEFP-XFFZJAGNSA-N |
| XLogP | 0.80 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|