C8H16N2O — CID 103988079
N,N-dimethyl-2-(oxolan-3-yl)ethanimidamide (PubChem CID 103988079) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N,N-dimethyl-2-(oxolan-3-yl)ethanimidamide.
| Compound Name | N,N-dimethyl-2-(oxolan-3-yl)ethanimidamide |
|---|---|
| PubChem CID | 103988079 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N,N-dimethyl-2-(oxolan-3-yl)ethanimidamide |
| SMILES | [H]/N=C(/CC1CCOC1)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-10(2)8(9)5-7-3-4-11-6-7/h7,9H,3-6H2,1-2H3/b9-8- |
| InChIKey | LGWOZQQXYYAUEG-HJWRWDBZSA-N |
| XLogP | 0.95 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|