C9H18N2O — CID 65329829
N,N-diethyloxolane-3-carboximidamide (PubChem CID 65329829) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is N,N-diethyloxolane-3-carboximidamide.
| Compound Name | N,N-diethyloxolane-3-carboximidamide |
|---|---|
| PubChem CID | 65329829 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | N,N-diethyloxolane-3-carboximidamide |
| SMILES | [H]/N=C(/C1CCOC1)N(CC)CC |
| InChI | InChI=1S/C9H18N2O/c1-3-11(4-2)9(10)8-5-6-12-7-8/h8,10H,3-7H2,1-2H3/b10-9- |
| InChIKey | AOMLGPVICDOPDW-KTKRTIGZSA-N |
| XLogP | 1.34 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|