C10H20N2O — CID 65333838
N,N-diethyloxane-3-carboximidamide (PubChem CID 65333838) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N,N-diethyloxane-3-carboximidamide.
| Compound Name | N,N-diethyloxane-3-carboximidamide |
|---|---|
| PubChem CID | 65333838 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N,N-diethyloxane-3-carboximidamide |
| SMILES | [H]/N=C(/C1CCCOC1)N(CC)CC |
| InChI | InChI=1S/C10H20N2O/c1-3-12(4-2)10(11)9-6-5-7-13-8-9/h9,11H,3-8H2,1-2H3/b11-10- |
| InChIKey | KEIWLGLBTIBXCW-KHPPLWFESA-N |
| XLogP | 1.73 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|