C9H15F2N3O3 — CID 139694578
2,2-difluoro-N,N-dimethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide (PubChem CID 139694578) has the molecular formula C9H15F2N3O3 and a molecular weight of 251.23 g/mol. Its IUPAC name is 2,2-difluoro-N,N-dimethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide.
| Compound Name | 2,2-difluoro-N,N-dimethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide |
|---|---|
| PubChem CID | 139694578 |
| Molecular Formula | C9H15F2N3O3 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2,2-difluoro-N,N-dimethyl-2-nitro-N'-(oxolan-3-ylmethyl)ethanimidamide |
| SMILES | CN(C)/C(=N\CC1CCOC1)C(F)(F)[N+](=O)[O-] |
| InChI | InChI=1S/C9H15F2N3O3/c1-13(2)8(9(10,11)14(15)16)12-5-7-3-4-17-6-7/h7H,3-6H2,1-2H3/b12-8- |
| InChIKey | VVKNQTXUFIRDMB-WQLSENKSSA-N |
| XLogP | 0.85 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|