C11H22N4O3S — CID 139702738
methyl N-[3-[methyl(oxolan-3-ylmethyl)amino]propyl]-N'-nitrocarbamimidothioate (PubChem CID 139702738) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is methyl N-[3-[methyl(oxolan-3-ylmethyl)amino]propyl]-N'-nitrocarbamimidothioate.
| Compound Name | methyl N-[3-[methyl(oxolan-3-ylmethyl)amino]propyl]-N'-nitrocarbamimidothioate |
|---|---|
| PubChem CID | 139702738 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl N-[3-[methyl(oxolan-3-ylmethyl)amino]propyl]-N'-nitrocarbamimidothioate |
| SMILES | CSC(=N[N+](=O)[O-])NCCCN(C)CC1CCOC1 |
| InChI | InChI=1S/C11H22N4O3S/c1-14(8-10-4-7-18-9-10)6-3-5-12-11(19-2)13-15(16)17/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | APMZIUITXQLYGT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|