C11H17Br2N3O3 — CID 139702931
2-[dibromo(nitro)methyl]-1-[(5-methyloxolan-3-yl)methyl]-5,6-dihydro-4H-pyrimidine (PubChem CID 139702931) has the molecular formula C11H17Br2N3O3 and a molecular weight of 399.08 g/mol. Its IUPAC name is 2-[dibromo(nitro)methyl]-1-[(5-methyloxolan-3-yl)methyl]-5,6-dihydro-4H-pyrimidine.
| Compound Name | 2-[dibromo(nitro)methyl]-1-[(5-methyloxolan-3-yl)methyl]-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 139702931 |
| Molecular Formula | C11H17Br2N3O3 |
| Molecular Weight | 399.08 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 2-[dibromo(nitro)methyl]-1-[(5-methyloxolan-3-yl)methyl]-5,6-dihydro-4H-pyrimidine |
| SMILES | CC1CC(CN2CCCN=C2C(Br)(Br)[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C11H17Br2N3O3/c1-8-5-9(7-19-8)6-15-4-2-3-14-10(15)11(12,13)16(17)18/h8-9H,2-7H2,1H3 |
| InChIKey | LPNIIIWFQSSEHV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.08 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|