C11H20BrN3O3 — CID 139702708
2-bromo-1-N,1-N,1-N'-trimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine (PubChem CID 139702708) has the molecular formula C11H20BrN3O3 and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-bromo-1-N,1-N,1-N'-trimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine.
| Compound Name | 2-bromo-1-N,1-N,1-N'-trimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 139702708 |
| Molecular Formula | C11H20BrN3O3 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-bromo-1-N,1-N,1-N'-trimethyl-1-N'-[(5-methyloxolan-3-yl)methyl]-2-nitroethene-1,1-diamine |
| SMILES | CC1CC(CN(C)C(=C(Br)[N+](=O)[O-])N(C)C)CO1 |
| InChI | InChI=1S/C11H20BrN3O3/c1-8-5-9(7-18-8)6-14(4)11(13(2)3)10(12)15(16)17/h8-9H,5-7H2,1-4H3 |
| InChIKey | IMNOPDXBVYVRDW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|