C15H29N3O3S — CID 139702840
1-N,3-N-dimethyl-1-N-[(5-methyloxolan-3-yl)methyl]-3-N-(1-methylsulfanyl-2-nitroethenyl)butane-1,3-diamine (PubChem CID 139702840) has the molecular formula C15H29N3O3S and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-1-N-[(5-methyloxolan-3-yl)methyl]-3-N-(1-methylsulfanyl-2-nitroethenyl)butane-1,3-diamine.
| Compound Name | 1-N,3-N-dimethyl-1-N-[(5-methyloxolan-3-yl)methyl]-3-N-(1-methylsulfanyl-2-nitroethenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 139702840 |
| Molecular Formula | C15H29N3O3S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-N,3-N-dimethyl-1-N-[(5-methyloxolan-3-yl)methyl]-3-N-(1-methylsulfanyl-2-nitroethenyl)butane-1,3-diamine |
| SMILES | CSC(=C[N+](=O)[O-])N(C)C(C)CCN(C)CC1COC(C)C1 |
| InChI | InChI=1S/C15H29N3O3S/c1-12(17(4)15(22-5)10-18(19)20)6-7-16(3)9-14-8-13(2)21-11-14/h10,12-14H,6-9,11H2,1-5H3 |
| InChIKey | NBFYOTPVWOJHBV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|