C10H17Br2N3O3 — CID 139694519
2,2-dibromo-N,N'-dimethyl-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide (PubChem CID 139694519) has the molecular formula C10H17Br2N3O3 and a molecular weight of 387.07 g/mol. Its IUPAC name is 2,2-dibromo-N,N'-dimethyl-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide.
| Compound Name | 2,2-dibromo-N,N'-dimethyl-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 139694519 |
| Molecular Formula | C10H17Br2N3O3 |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | 2,2-dibromo-N,N'-dimethyl-N-[(5-methyloxolan-3-yl)methyl]-2-nitroethanimidamide |
| SMILES | C/N=C(\N(C)CC1COC(C)C1)C(Br)(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C10H17Br2N3O3/c1-7-4-8(6-18-7)5-14(3)9(13-2)10(11,12)15(16)17/h7-8H,4-6H2,1-3H3/b13-9- |
| InChIKey | CYOOOAVFEYEYSD-LCYFTJDESA-N |
| XLogP | 2.09 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|