C16H18Cl2N4O5 — CID 139678386
(3,4-dichlorophenyl) 3-[(5-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate (PubChem CID 139678386) has the molecular formula C16H18Cl2N4O5 and a molecular weight of 417.25 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 3-[(5-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate.
| Compound Name | (3,4-dichlorophenyl) 3-[(5-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 139678386 |
| Molecular Formula | C16H18Cl2N4O5 |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (3,4-dichlorophenyl) 3-[(5-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate |
| SMILES | CC1CC(CN2CCN(C(=O)Oc3ccc(Cl)c(Cl)c3)C2=N[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C16H18Cl2N4O5/c1-10-6-11(9-26-10)8-20-4-5-21(15(20)19-22(24)25)16(23)27-12-2-3-13(17)14(18)7-12/h2-3,7,10-11H,4-6,8-9H2,1H3 |
| InChIKey | BAIAJYYMCZWEMG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|