C16H19ClN4O5 — CID 139678443
(3-chlorophenyl) 3-[(4-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate (PubChem CID 139678443) has the molecular formula C16H19ClN4O5 and a molecular weight of 382.80 g/mol. Its IUPAC name is (3-chlorophenyl) 3-[(4-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate.
| Compound Name | (3-chlorophenyl) 3-[(4-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 139678443 |
| Molecular Formula | C16H19ClN4O5 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (3-chlorophenyl) 3-[(4-methyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate |
| SMILES | CC1COCC1CN1CCN(C(=O)Oc2cccc(Cl)c2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C16H19ClN4O5/c1-11-9-25-10-12(11)8-19-5-6-20(15(19)18-21(23)24)16(22)26-14-4-2-3-13(17)7-14/h2-4,7,11-12H,5-6,8-10H2,1H3 |
| InChIKey | YVHQRVHIHXJVCB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|