C15H28N4O4 — CID 139678677
N-[1-[(4-methyloxolan-3-yl)methyl]-3-(1-propan-2-yloxypropyl)imidazolidin-2-ylidene]nitramide (PubChem CID 139678677) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[1-[(4-methyloxolan-3-yl)methyl]-3-(1-propan-2-yloxypropyl)imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-[(4-methyloxolan-3-yl)methyl]-3-(1-propan-2-yloxypropyl)imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678677 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | N-[1-[(4-methyloxolan-3-yl)methyl]-3-(1-propan-2-yloxypropyl)imidazolidin-2-ylidene]nitramide |
| SMILES | CCC(OC(C)C)N1CCN(CC2COCC2C)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C15H28N4O4/c1-5-14(23-11(2)3)18-7-6-17(15(18)16-19(20)21)8-13-10-22-9-12(13)4/h11-14H,5-10H2,1-4H3 |
| InChIKey | YLGUVQPIEXAPJM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|