C12H18N4O3 — CID 139678290
N-[1-[(4-methyloxolan-3-yl)methyl]-3-prop-2-ynylimidazolidin-2-ylidene]nitramide (PubChem CID 139678290) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[1-[(4-methyloxolan-3-yl)methyl]-3-prop-2-ynylimidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-[(4-methyloxolan-3-yl)methyl]-3-prop-2-ynylimidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678290 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-[1-[(4-methyloxolan-3-yl)methyl]-3-prop-2-ynylimidazolidin-2-ylidene]nitramide |
| SMILES | C#CCN1CCN(CC2COCC2C)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O3/c1-3-4-14-5-6-15(12(14)13-16(17)18)7-11-9-19-8-10(11)2/h1,10-11H,4-9H2,2H3 |
| InChIKey | UUHKKSFSZRPRIU-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|