C11H21N4O4P — CID 139678586
N-[1-dimethylphosphoryl-3-[(4-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide (PubChem CID 139678586) has the molecular formula C11H21N4O4P and a molecular weight of 304.29 g/mol. Its IUPAC name is N-[1-dimethylphosphoryl-3-[(4-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-dimethylphosphoryl-3-[(4-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678586 |
| Molecular Formula | C11H21N4O4P |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-[1-dimethylphosphoryl-3-[(4-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
| SMILES | CC1COCC1CN1CCN(P(C)(C)=O)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C11H21N4O4P/c1-9-7-19-8-10(9)6-13-4-5-14(20(2,3)18)11(13)12-15(16)17/h9-10H,4-8H2,1-3H3 |
| InChIKey | YWKXYNLFPKMELB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|