C17H22N4O5 — CID 139678769
phenyl 3-[(5,5-dimethyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate (PubChem CID 139678769) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is phenyl 3-[(5,5-dimethyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate.
| Compound Name | phenyl 3-[(5,5-dimethyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 139678769 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | phenyl 3-[(5,5-dimethyloxolan-3-yl)methyl]-2-nitroiminoimidazolidine-1-carboxylate |
| SMILES | CC1(C)CC(CN2CCN(C(=O)Oc3ccccc3)C2=N[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C17H22N4O5/c1-17(2)10-13(12-25-17)11-19-8-9-20(15(19)18-21(23)24)16(22)26-14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3 |
| InChIKey | ZYSMBRPXMSORSB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|