About phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate
phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate (PubChem CID 46499556) has the molecular formula C12H15N5O4
and a molecular weight of 293.28 g/mol. Its IUPAC name is phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate |
| PubChem CID | 46499556 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate |
| SMILES | N/C(=N\[N+](=O)[O-])N1CCN(C(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C12H15N5O4/c13-11(14-17(19)20)15-6-8-16(9-7-15)12(18)21-10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,13,14) |
| InChIKey | FCHBSHGEAPBCJN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate?
The IUPAC name of phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate (CID 46499556) is phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate.
What is the SMILES notation for phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate?
The canonical SMILES for phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate is N/C(=N\[N+](=O)[O-])N1CCN(C(=O)Oc2ccccc2)CC1.
What is the InChIKey of phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate?
The InChIKey is FCHBSHGEAPBCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N5O4/c13-11(14-17(19)20)15-6-8-16(9-7-15)12(18)21-10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,13,14).
What are the key properties of phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate?
phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate has a molecular weight of 293.28 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-[(E)-N'-nitrocarbamimidoyl]piperazine-1-carboxylate is sourced from PubChem (CID 46499556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).