C17H21BrN4O3 — CID 139678560
N-[1-[2-(2-bromophenyl)ethenyl]-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide (PubChem CID 139678560) has the molecular formula C17H21BrN4O3 and a molecular weight of 409.28 g/mol. Its IUPAC name is N-[1-[2-(2-bromophenyl)ethenyl]-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-[2-(2-bromophenyl)ethenyl]-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678560 |
| Molecular Formula | C17H21BrN4O3 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-[1-[2-(2-bromophenyl)ethenyl]-3-[(5-methyloxolan-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
| SMILES | CC1CC(CN2CCN(C=Cc3ccccc3Br)C2=N[N+](=O)[O-])CO1 |
| InChI | InChI=1S/C17H21BrN4O3/c1-13-10-14(12-25-13)11-21-9-8-20(17(21)19-22(23)24)7-6-15-4-2-3-5-16(15)18/h2-7,13-14H,8-12H2,1H3 |
| InChIKey | SPERNSXWTGGRAN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|