C13H25N5O3 — CID 139743741
N-[5-tert-butyl-1-methyl-3-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 139743741) has the molecular formula C13H25N5O3 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[5-tert-butyl-1-methyl-3-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | N-[5-tert-butyl-1-methyl-3-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139743741 |
| Molecular Formula | C13H25N5O3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-[5-tert-butyl-1-methyl-3-(oxolan-3-ylmethyl)-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CN1CN(C(C)(C)C)CN(CC2CCOC2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C13H25N5O3/c1-13(2,3)17-9-15(4)12(14-18(19)20)16(10-17)7-11-5-6-21-8-11/h11H,5-10H2,1-4H3 |
| InChIKey | LQQUSMFGKFBAMY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|