C10H12N6O4 — CID 135419935
(NE)-N-[1-methyl-5-(4-nitrophenyl)-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 135419935) has the molecular formula C10H12N6O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is (NE)-N-[1-methyl-5-(4-nitrophenyl)-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NE)-N-[1-methyl-5-(4-nitrophenyl)-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135419935 |
| Molecular Formula | C10H12N6O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (NE)-N-[1-methyl-5-(4-nitrophenyl)-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CN1CN(c2ccc([N+](=O)[O-])cc2)CN/C1=N\[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N6O4/c1-13-7-14(6-11-10(13)12-16(19)20)8-2-4-9(5-3-8)15(17)18/h2-5H,6-7H2,1H3,(H,11,12) |
| InChIKey | UFHPOHAYAZXMEH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|