C23H27Cl3N8O3 — CID 136664434
(NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol (PubChem CID 136664434) has the molecular formula C23H27Cl3N8O3 and a molecular weight of 569.88 g/mol. Its IUPAC name is (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol.
| Compound Name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol |
|---|---|
| PubChem CID | 136664434 |
| Molecular Formula | C23H27Cl3N8O3 |
| Molecular Weight | 569.88 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | (NE)-N-[1-[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]nitramide;2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol |
| SMILES | CCCCC(O)(Cn1cncn1)c1ccc(Cl)cc1Cl.O=[N+]([O-])/N=C1\NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H17Cl2N3O.C9H10ClN5O2/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16;10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h4-5,7,9-10,20H,2-3,6,8H2,1H3;1-2,5H,3-4,6H2,(H,11,13) |
| InChIKey | GEXFLHZOEHWLPK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.88 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|