C11H13ClN4S — CID 172923550
(Z)-3-[(6-chloro-3-pyridinyl)methyl]-N-isocyano-1,3-thiazolidin-2-imine;methane (PubChem CID 172923550) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is (Z)-3-[(6-chloro-3-pyridinyl)methyl]-N-isocyano-1,3-thiazolidin-2-imine;methane.
| Compound Name | (Z)-3-[(6-chloro-3-pyridinyl)methyl]-N-isocyano-1,3-thiazolidin-2-imine;methane |
|---|---|
| PubChem CID | 172923550 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (Z)-3-[(6-chloro-3-pyridinyl)methyl]-N-isocyano-1,3-thiazolidin-2-imine;methane |
| SMILES | C.[C-]#[N+]/N=C1\SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H9ClN4S.CH4/c1-12-14-10-15(4-5-16-10)7-8-2-3-9(11)13-6-8;/h2-3,6H,4-5,7H2;1H4/b14-10-; |
| InChIKey | LUGITSNBENBYLD-DZOOLQPHSA-N |
| XLogP | 3.11 |
| TPSA | 32.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|