C9H10Cl2N4 — CID 162345034
N-chloro-1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-amine (PubChem CID 162345034) has the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. Its IUPAC name is N-chloro-1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-amine.
| Compound Name | N-chloro-1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 162345034 |
| Molecular Formula | C9H10Cl2N4 |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | N-chloro-1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-amine |
| SMILES | ClNC1=NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H10Cl2N4/c10-8-2-1-7(5-13-8)6-15-4-3-12-9(15)14-11/h1-2,5H,3-4,6H2,(H,12,14) |
| InChIKey | AZZSVFQPQWRHJE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|