C19H19ClF3N5O2S — CID 123284899
N-[(E)-[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-(trifluoromethylsulfonyl)methylidene]amino]-2,6-dimethylaniline (PubChem CID 123284899) has the molecular formula C19H19ClF3N5O2S and a molecular weight of 473.91 g/mol. Its IUPAC name is N-[(E)-[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-(trifluoromethylsulfonyl)methylidene]amino]-2,6-dimethylaniline.
| Compound Name | N-[(E)-[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-(trifluoromethylsulfonyl)methylidene]amino]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 123284899 |
| Molecular Formula | C19H19ClF3N5O2S |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | N-[(E)-[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-(trifluoromethylsulfonyl)methylidene]amino]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1N/N=C(\C1=NCCN1Cc1ccc(Cl)nc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H19ClF3N5O2S/c1-12-4-3-5-13(2)16(12)26-27-18(31(29,30)19(21,22)23)17-24-8-9-28(17)11-14-6-7-15(20)25-10-14/h3-7,10,26H,8-9,11H2,1-2H3/b27-18+ |
| InChIKey | JGXTXCJTPZVION-OVVQPSECSA-N |
| XLogP | 3.93 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|