C14H12ClN7O5 — CID 163555602
N-[[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-nitromethylidene]amino]-5-nitrofuran-2-amine (PubChem CID 163555602) has the molecular formula C14H12ClN7O5 and a molecular weight of 393.75 g/mol. Its IUPAC name is N-[[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-nitromethylidene]amino]-5-nitrofuran-2-amine.
| Compound Name | N-[[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-nitromethylidene]amino]-5-nitrofuran-2-amine |
|---|---|
| PubChem CID | 163555602 |
| Molecular Formula | C14H12ClN7O5 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[[[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]-nitromethylidene]amino]-5-nitrofuran-2-amine |
| SMILES | O=[N+]([O-])C(=NNc1ccc([N+](=O)[O-])o1)C1=NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H12ClN7O5/c15-10-2-1-9(7-17-10)8-20-6-5-16-13(20)14(22(25)26)19-18-11-3-4-12(27-11)21(23)24/h1-4,7,18H,5-6,8H2 |
| InChIKey | RLTMQOSTDFXXRF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 152.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|