C15H13ClN4O3 — CID 74429354
2-chloro-5-[[2-[2-(furan-3-yl)-1-nitroethenyl]-4,5-dihydroimidazol-1-yl]methyl]pyridine (PubChem CID 74429354) has the molecular formula C15H13ClN4O3 and a molecular weight of 332.75 g/mol. Its IUPAC name is 2-chloro-5-[[2-[2-(furan-3-yl)-1-nitroethenyl]-4,5-dihydroimidazol-1-yl]methyl]pyridine.
| Compound Name | 2-chloro-5-[[2-[2-(furan-3-yl)-1-nitroethenyl]-4,5-dihydroimidazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 74429354 |
| Molecular Formula | C15H13ClN4O3 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-chloro-5-[[2-[2-(furan-3-yl)-1-nitroethenyl]-4,5-dihydroimidazol-1-yl]methyl]pyridine |
| SMILES | O=[N+]([O-])C(=Cc1ccoc1)C1=NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H13ClN4O3/c16-14-2-1-12(8-18-14)9-19-5-4-17-15(19)13(20(21)22)7-11-3-6-23-10-11/h1-3,6-8,10H,4-5,9H2 |
| InChIKey | CLZYEGGNUSFNKV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|