C21H24Cl2N5O3P — CID 25001984
2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-diethoxyphosphorylacetonitrile (PubChem CID 25001984) has the molecular formula C21H24Cl2N5O3P and a molecular weight of 496.34 g/mol. Its IUPAC name is 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-diethoxyphosphorylacetonitrile.
| Compound Name | 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-diethoxyphosphorylacetonitrile |
|---|---|
| PubChem CID | 25001984 |
| Molecular Formula | C21H24Cl2N5O3P |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-diethoxyphosphorylacetonitrile |
| SMILES | CCOP(=O)(OCC)C(C#N)=C1N(Cc2ccc(Cl)nc2)CCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C21H24Cl2N5O3P/c1-3-30-32(29,31-4-2)18(11-24)21-27(14-16-5-7-19(22)25-12-16)9-10-28(21)15-17-6-8-20(23)26-13-17/h5-8,12-13H,3-4,9-10,14-15H2,1-2H3 |
| InChIKey | QOLYVXAZPAPARK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 91.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|