C14H21ClNO5P — CID 58944751
ethyl 3-(6-chloro-3-pyridinyl)-2-diethoxyphosphorylpropanoate (PubChem CID 58944751) has the molecular formula C14H21ClNO5P and a molecular weight of 349.75 g/mol. Its IUPAC name is ethyl 3-(6-chloro-3-pyridinyl)-2-diethoxyphosphorylpropanoate.
| Compound Name | ethyl 3-(6-chloro-3-pyridinyl)-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 58944751 |
| Molecular Formula | C14H21ClNO5P |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | ethyl 3-(6-chloro-3-pyridinyl)-2-diethoxyphosphorylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(Cl)nc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H21ClNO5P/c1-4-19-14(17)12(22(18,20-5-2)21-6-3)9-11-7-8-13(15)16-10-11/h7-8,10,12H,4-6,9H2,1-3H3 |
| InChIKey | LQSPDUZABONKHM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|