About ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate
ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate (PubChem CID 139069540) has the molecular formula C22H25Cl2N5O3
and a molecular weight of 478.38 g/mol. Its IUPAC name is ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate.
Molecular Properties
| Compound Name | ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate |
| PubChem CID | 139069540 |
| Molecular Formula | C22H25Cl2N5O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate |
| SMILES | CCO.CCOC(=O)C(C#N)=C1N(Cc2ccc(Cl)nc2)CCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H19Cl2N5O2.C2H6O/c1-2-29-20(28)16(9-23)19-26(12-14-3-5-17(21)24-10-14)7-8-27(19)13-15-4-6-18(22)25-11-15;1-2-3/h3-6,10-11H,2,7-8,12-13H2,1H3;3H,2H2,1H3 |
| InChIKey | OCFXGXYCVAVVCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate?
The IUPAC name of ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate (CID 139069540) is ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate.
What is the SMILES notation for ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate?
The canonical SMILES for ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate is CCO.CCOC(=O)C(C#N)=C1N(Cc2ccc(Cl)nc2)CCN1Cc1ccc(Cl)nc1.
What is the InChIKey of ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate?
The InChIKey is OCFXGXYCVAVVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2N5O2.C2H6O/c1-2-29-20(28)16(9-23)19-26(12-14-3-5-17(21)24-10-14)7-8-27(19)13-15-4-6-18(22)25-11-15;1-2-3/h3-6,10-11H,2,7-8,12-13H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate?
ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate has a molecular weight of 478.38 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;ethyl 2-[1,3-bis[(6-chloro-3-pyridinyl)methyl]imidazolidin-2-ylidene]-2-cyanoacetate is sourced from PubChem (CID 139069540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).