C14H17ClN4O4 — CID 89392554
1-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8-nitro-2,3,4,7-tetrahydropyrrolo[1,2-a]pyrimidine-6,7-diol (PubChem CID 89392554) has the molecular formula C14H17ClN4O4 and a molecular weight of 340.77 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8-nitro-2,3,4,7-tetrahydropyrrolo[1,2-a]pyrimidine-6,7-diol.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8-nitro-2,3,4,7-tetrahydropyrrolo[1,2-a]pyrimidine-6,7-diol |
|---|---|
| PubChem CID | 89392554 |
| Molecular Formula | C14H17ClN4O4 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-6-methyl-8-nitro-2,3,4,7-tetrahydropyrrolo[1,2-a]pyrimidine-6,7-diol |
| SMILES | CC1(O)C(O)C([N+](=O)[O-])=C2N(Cc3ccc(Cl)nc3)CCCN21 |
| InChI | InChI=1S/C14H17ClN4O4/c1-14(21)12(20)11(19(22)23)13-17(5-2-6-18(13)14)8-9-3-4-10(15)16-7-9/h3-4,7,12,20-21H,2,5-6,8H2,1H3 |
| InChIKey | QKVZIERMPNHMQX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|