C13H15ClN4O5 — CID 89392550
1-[(6-chloro-3-pyridinyl)methyl]-5-methoxy-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole-5,6-diol (PubChem CID 89392550) has the molecular formula C13H15ClN4O5 and a molecular weight of 342.74 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-5-methoxy-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole-5,6-diol.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-5-methoxy-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole-5,6-diol |
|---|---|
| PubChem CID | 89392550 |
| Molecular Formula | C13H15ClN4O5 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-5-methoxy-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole-5,6-diol |
| SMILES | COC1(O)C(O)C([N+](=O)[O-])=C2N(Cc3ccc(Cl)nc3)CCN21 |
| InChI | InChI=1S/C13H15ClN4O5/c1-23-13(20)11(19)10(18(21)22)12-16(4-5-17(12)13)7-8-2-3-9(14)15-6-8/h2-3,6,11,19-20H,4-5,7H2,1H3 |
| InChIKey | OSYHLJIJVDRQHA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|