C19H27ClN4O3 — CID 44571986
1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-5-propoxy-7-propyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine (PubChem CID 44571986) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-5-propoxy-7-propyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-5-propoxy-7-propyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 44571986 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-5-propoxy-7-propyl-3,5,6,7-tetrahydro-2H-imidazo[1,2-a]pyridine |
| SMILES | CCCOC1CC(CCC)C([N+](=O)[O-])=C2N(Cc3ccc(Cl)nc3)CCN21 |
| InChI | InChI=1S/C19H27ClN4O3/c1-3-5-15-11-17(27-10-4-2)23-9-8-22(19(23)18(15)24(25)26)13-14-6-7-16(20)21-12-14/h6-7,12,15,17H,3-5,8-11,13H2,1-2H3 |
| InChIKey | AMVOHPRTAVBEHH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|