C20H16ClN7O4 — CID 45278119
5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile (PubChem CID 45278119) has the molecular formula C20H16ClN7O4 and a molecular weight of 453.85 g/mol. Its IUPAC name is 5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile.
| Compound Name | 5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 45278119 |
| Molecular Formula | C20H16ClN7O4 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 5-amino-1-[(6-chloro-3-pyridinyl)methyl]-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-imidazo[1,2-a]pyridine-6-carbonitrile |
| SMILES | N#CC1=C(N)N2CCN(Cc3ccc(Cl)nc3)C2=C([N+](=O)[O-])C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16ClN7O4/c21-16-6-1-12(10-24-16)11-25-7-8-26-19(23)15(9-22)17(18(20(25)26)28(31)32)13-2-4-14(5-3-13)27(29)30/h1-6,10,17H,7-8,11,23H2 |
| InChIKey | MVLSCVVCMPERLY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 155.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|