C14H11N5O4S — CID 56851655
5-amino-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-6-carbonitrile (PubChem CID 56851655) has the molecular formula C14H11N5O4S and a molecular weight of 345.34 g/mol. Its IUPAC name is 5-amino-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-6-carbonitrile.
| Compound Name | 5-amino-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 56851655 |
| Molecular Formula | C14H11N5O4S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 5-amino-8-nitro-7-(4-nitrophenyl)-3,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-6-carbonitrile |
| SMILES | N#CC1=C(N)N2CCSC2=C([N+](=O)[O-])C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H11N5O4S/c15-7-10-11(8-1-3-9(4-2-8)18(20)21)12(19(22)23)14-17(13(10)16)5-6-24-14/h1-4,11H,5-6,16H2 |
| InChIKey | PWDRFPNEEYUKSN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 139.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|