C16H11N5O3S — CID 17273401
6-amino-8-(3-nitrophenyl)-4-oxo-3,8-dihydro-2H-pyrido[2,1-b][1,3]thiazine-7,9-dicarbonitrile (PubChem CID 17273401) has the molecular formula C16H11N5O3S and a molecular weight of 353.36 g/mol. Its IUPAC name is 6-amino-8-(3-nitrophenyl)-4-oxo-3,8-dihydro-2H-pyrido[2,1-b][1,3]thiazine-7,9-dicarbonitrile.
| Compound Name | 6-amino-8-(3-nitrophenyl)-4-oxo-3,8-dihydro-2H-pyrido[2,1-b][1,3]thiazine-7,9-dicarbonitrile |
|---|---|
| PubChem CID | 17273401 |
| Molecular Formula | C16H11N5O3S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 6-amino-8-(3-nitrophenyl)-4-oxo-3,8-dihydro-2H-pyrido[2,1-b][1,3]thiazine-7,9-dicarbonitrile |
| SMILES | N#CC1=C(N)N2C(=O)CCSC2=C(C#N)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11N5O3S/c17-7-11-14(9-2-1-3-10(6-9)21(23)24)12(8-18)16-20(15(11)19)13(22)4-5-25-16/h1-3,6,14H,4-5,19H2 |
| InChIKey | UZPHNHMTGITKMK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|