C21H18N4O5S — CID 42588886
(7S)-5-amino-4-(4-methoxyphenyl)-7-(3-nitrophenyl)-1,1-dioxo-3,7-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile (PubChem CID 42588886) has the molecular formula C21H18N4O5S and a molecular weight of 438.47 g/mol. Its IUPAC name is (7S)-5-amino-4-(4-methoxyphenyl)-7-(3-nitrophenyl)-1,1-dioxo-3,7-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile.
| Compound Name | (7S)-5-amino-4-(4-methoxyphenyl)-7-(3-nitrophenyl)-1,1-dioxo-3,7-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 42588886 |
| Molecular Formula | C21H18N4O5S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (7S)-5-amino-4-(4-methoxyphenyl)-7-(3-nitrophenyl)-1,1-dioxo-3,7-dihydro-2H-thieno[3,2-b]pyridine-6-carbonitrile |
| SMILES | COc1ccc(N2C(N)=C(C#N)[C@H](c3cccc([N+](=O)[O-])c3)C3=C2CCS3(=O)=O)cc1 |
| InChI | InChI=1S/C21H18N4O5S/c1-30-16-7-5-14(6-8-16)24-18-9-10-31(28,29)20(18)19(17(12-22)21(24)23)13-3-2-4-15(11-13)25(26)27/h2-8,11,19H,9-10,23H2,1H3/t19-/m0/s1 |
| InChIKey | PRBZYPXZMKUNAE-IBGZPJMESA-N |
| XLogP | 2.93 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|