C15H19ClN4O4 — CID 71517943
1-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethoxy-5-methyl-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole (PubChem CID 71517943) has the molecular formula C15H19ClN4O4 and a molecular weight of 354.79 g/mol. Its IUPAC name is 1-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethoxy-5-methyl-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole.
| Compound Name | 1-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethoxy-5-methyl-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole |
|---|---|
| PubChem CID | 71517943 |
| Molecular Formula | C15H19ClN4O4 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-[(6-chloro-3-pyridinyl)methyl]-5,6-dimethoxy-5-methyl-7-nitro-3,6-dihydro-2H-pyrrolo[1,2-a]imidazole |
| SMILES | COC1C([N+](=O)[O-])=C2N(Cc3ccc(Cl)nc3)CCN2C1(C)OC |
| InChI | InChI=1S/C15H19ClN4O4/c1-15(24-3)13(23-2)12(20(21)22)14-18(6-7-19(14)15)9-10-4-5-11(16)17-8-10/h4-5,8,13H,6-7,9H2,1-3H3 |
| InChIKey | XAYBFOISZSSFGO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|