C17H18ClN3O2S — CID 102506802
N-(1-benzyl-5,6-dihydro-4H-pyrimidin-2-yl)-4-chlorobenzenesulfonamide (PubChem CID 102506802) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is N-(1-benzyl-5,6-dihydro-4H-pyrimidin-2-yl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(1-benzyl-5,6-dihydro-4H-pyrimidin-2-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 102506802 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-(1-benzyl-5,6-dihydro-4H-pyrimidin-2-yl)-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1=NCCCN1Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O2S/c18-15-7-9-16(10-8-15)24(22,23)20-17-19-11-4-12-21(17)13-14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2,(H,19,20) |
| InChIKey | ZRJVNEGGDOLKMK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |