C19H23N3OS — CID 20662394
2-[[1-methyl-3-(piperidin-1-ylmethyl)indol-2-yl]methoxy]-1,3-thiazole (PubChem CID 20662394) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-[[1-methyl-3-(piperidin-1-ylmethyl)indol-2-yl]methoxy]-1,3-thiazole.
| Compound Name | 2-[[1-methyl-3-(piperidin-1-ylmethyl)indol-2-yl]methoxy]-1,3-thiazole |
|---|---|
| PubChem CID | 20662394 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[[1-methyl-3-(piperidin-1-ylmethyl)indol-2-yl]methoxy]-1,3-thiazole |
| SMILES | Cn1c(COc2nccs2)c(CN2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C19H23N3OS/c1-21-17-8-4-3-7-15(17)16(13-22-10-5-2-6-11-22)18(21)14-23-19-20-9-12-24-19/h3-4,7-9,12H,2,5-6,10-11,13-14H2,1H3 |
| InChIKey | FKNJLDWLJBMGDF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|