C19H29N3 — CID 170864109
2-ethyl-1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]indole (PubChem CID 170864109) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-ethyl-1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]indole.
| Compound Name | 2-ethyl-1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]indole |
|---|---|
| PubChem CID | 170864109 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-ethyl-1-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]indole |
| SMILES | CCc1c(CCCN2CCN(C)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C19H29N3/c1-4-18-16(17-8-5-6-10-19(17)21(18)3)9-7-11-22-14-12-20(2)13-15-22/h5-6,8,10H,4,7,9,11-15H2,1-3H3 |
| InChIKey | RZIBJFPOLNMCEE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|