C18H27N3 — CID 170864121
2,7-dimethyl-3-[3-(4-methylpiperazin-1-yl)propyl]-1H-indole (PubChem CID 170864121) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2,7-dimethyl-3-[3-(4-methylpiperazin-1-yl)propyl]-1H-indole.
| Compound Name | 2,7-dimethyl-3-[3-(4-methylpiperazin-1-yl)propyl]-1H-indole |
|---|---|
| PubChem CID | 170864121 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2,7-dimethyl-3-[3-(4-methylpiperazin-1-yl)propyl]-1H-indole |
| SMILES | Cc1[nH]c2c(C)cccc2c1CCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H27N3/c1-14-6-4-7-17-16(15(2)19-18(14)17)8-5-9-21-12-10-20(3)11-13-21/h4,6-7,19H,5,8-13H2,1-3H3 |
| InChIKey | UVDAYXRNZXOISZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|