C27H33Cl2N3O — CID 21196214
2-[(2,4-dichlorophenoxy)methyl]-1-methyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indole (PubChem CID 21196214) has the molecular formula C27H33Cl2N3O and a molecular weight of 486.49 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenoxy)methyl]-1-methyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indole.
| Compound Name | 2-[(2,4-dichlorophenoxy)methyl]-1-methyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indole |
|---|---|
| PubChem CID | 21196214 |
| Molecular Formula | C27H33Cl2N3O |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-[(2,4-dichlorophenoxy)methyl]-1-methyl-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indole |
| SMILES | Cn1c(COc2ccc(Cl)cc2Cl)c(CN2CCC(N3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H33Cl2N3O/c1-30-25-8-4-3-7-22(25)23(26(30)19-33-27-10-9-20(28)17-24(27)29)18-31-15-11-21(12-16-31)32-13-5-2-6-14-32/h3-4,7-10,17,21H,2,5-6,11-16,18-19H2,1H3 |
| InChIKey | SXKQKLAVWGKJMJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 20.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|