C24H27Cl2N3O3 — CID 20662397
2-[2-[(2,4-dichlorophenoxy)methyl]-1-methylindol-3-yl]-N-[3-(dimethylamino)propyl]-N-methyl-2-oxoacetamide (PubChem CID 20662397) has the molecular formula C24H27Cl2N3O3 and a molecular weight of 476.40 g/mol. Its IUPAC name is 2-[2-[(2,4-dichlorophenoxy)methyl]-1-methylindol-3-yl]-N-[3-(dimethylamino)propyl]-N-methyl-2-oxoacetamide.
| Compound Name | 2-[2-[(2,4-dichlorophenoxy)methyl]-1-methylindol-3-yl]-N-[3-(dimethylamino)propyl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 20662397 |
| Molecular Formula | C24H27Cl2N3O3 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 2-[2-[(2,4-dichlorophenoxy)methyl]-1-methylindol-3-yl]-N-[3-(dimethylamino)propyl]-N-methyl-2-oxoacetamide |
| SMILES | CN(C)CCCN(C)C(=O)C(=O)c1c(COc2ccc(Cl)cc2Cl)n(C)c2ccccc12 |
| InChI | InChI=1S/C24H27Cl2N3O3/c1-27(2)12-7-13-28(3)24(31)23(30)22-17-8-5-6-9-19(17)29(4)20(22)15-32-21-11-10-16(25)14-18(21)26/h5-6,8-11,14H,7,12-13,15H2,1-4H3 |
| InChIKey | MLEYBVVBKBOOKD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|