C17H13Cl2NO3 — CID 99965989
2-(2,4-dichlorophenoxy)-1-[3-(hydroxymethyl)indol-1-yl]ethanone (PubChem CID 99965989) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[3-(hydroxymethyl)indol-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[3-(hydroxymethyl)indol-1-yl]ethanone |
|---|---|
| PubChem CID | 99965989 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[3-(hydroxymethyl)indol-1-yl]ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)n1cc(CO)c2ccccc21 |
| InChI | InChI=1S/C17H13Cl2NO3/c18-12-5-6-16(14(19)7-12)23-10-17(22)20-8-11(9-21)13-3-1-2-4-15(13)20/h1-8,21H,9-10H2 |
| InChIKey | ZSQIXISCVGXVLB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |