C28H28ClN3O2 — CID 20662366
1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 20662366) has the molecular formula C28H28ClN3O2 and a molecular weight of 474.00 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 20662366 |
| Molecular Formula | C28H28ClN3O2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | Cn1c(COc2ccc(Cl)cc2)c(C(=O)CN2CCN(c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H28ClN3O2/c1-30-25-10-6-5-9-24(25)28(26(30)20-34-23-13-11-21(29)12-14-23)27(33)19-31-15-17-32(18-16-31)22-7-3-2-4-8-22/h2-14H,15-20H2,1H3 |
| InChIKey | BMCPTLXWNYVRRJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |