C24H27ClN2O2 — CID 21196197
1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-piperidin-4-ylpropan-1-one (PubChem CID 21196197) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-piperidin-4-ylpropan-1-one.
| Compound Name | 1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-piperidin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 21196197 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[2-[(4-chlorophenoxy)methyl]-1-methylindol-3-yl]-2-piperidin-4-ylpropan-1-one |
| SMILES | CC(C(=O)c1c(COc2ccc(Cl)cc2)n(C)c2ccccc12)C1CCNCC1 |
| InChI | InChI=1S/C24H27ClN2O2/c1-16(17-11-13-26-14-12-17)24(28)23-20-5-3-4-6-21(20)27(2)22(23)15-29-19-9-7-18(25)8-10-19/h3-10,16-17,26H,11-15H2,1-2H3 |
| InChIKey | WNAUYCJCAQXOQT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |